C14H12F6N2O2 — CID 90511911
1-acetyl-N-[3,5-bis(trifluoromethyl)phenyl]azetidine-3-carboxamide (PubChem CID 90511911) has the molecular formula C14H12F6N2O2 and a molecular weight of 354.25 g/mol. Its IUPAC name is 1-acetyl-N-[3,5-bis(trifluoromethyl)phenyl]azetidine-3-carboxamide.
| Compound Name | 1-acetyl-N-[3,5-bis(trifluoromethyl)phenyl]azetidine-3-carboxamide |
|---|---|
| PubChem CID | 90511911 |
| Molecular Formula | C14H12F6N2O2 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 1-acetyl-N-[3,5-bis(trifluoromethyl)phenyl]azetidine-3-carboxamide |
| SMILES | CC(=O)N1CC(C(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C14H12F6N2O2/c1-7(23)22-5-8(6-22)12(24)21-11-3-9(13(15,16)17)2-10(4-11)14(18,19)20/h2-4,8H,5-6H2,1H3,(H,21,24) |
| InChIKey | FQVLYDDVQIBHRE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |