C14H13N3O6 — CID 90512094
N-(furan-2-ylmethyl)-1-(5-nitrofuran-2-carbonyl)azetidine-3-carboxamide (PubChem CID 90512094) has the molecular formula C14H13N3O6 and a molecular weight of 319.27 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1-(5-nitrofuran-2-carbonyl)azetidine-3-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-1-(5-nitrofuran-2-carbonyl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 90512094 |
| Molecular Formula | C14H13N3O6 |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | N-(furan-2-ylmethyl)-1-(5-nitrofuran-2-carbonyl)azetidine-3-carboxamide |
| SMILES | O=C(NCc1ccco1)C1CN(C(=O)c2ccc([N+](=O)[O-])o2)C1 |
| InChI | InChI=1S/C14H13N3O6/c18-13(15-6-10-2-1-5-22-10)9-7-16(8-9)14(19)11-3-4-12(23-11)17(20)21/h1-5,9H,6-8H2,(H,15,18) |
| InChIKey | XVWFCLUKMQUHMN-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 118.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|