C24H20N2O5 — CID 90512913
1-(1,3-benzodioxole-5-carbonyl)-N-(2-phenoxyphenyl)azetidine-3-carboxamide (PubChem CID 90512913) has the molecular formula C24H20N2O5 and a molecular weight of 416.43 g/mol. Its IUPAC name is 1-(1,3-benzodioxole-5-carbonyl)-N-(2-phenoxyphenyl)azetidine-3-carboxamide.
| Compound Name | 1-(1,3-benzodioxole-5-carbonyl)-N-(2-phenoxyphenyl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 90512913 |
| Molecular Formula | C24H20N2O5 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 1-(1,3-benzodioxole-5-carbonyl)-N-(2-phenoxyphenyl)azetidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1Oc1ccccc1)C1CN(C(=O)c2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C24H20N2O5/c27-23(25-19-8-4-5-9-20(19)31-18-6-2-1-3-7-18)17-13-26(14-17)24(28)16-10-11-21-22(12-16)30-15-29-21/h1-12,17H,13-15H2,(H,25,27) |
| InChIKey | WGWRFPAMPLYENW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |