C11H12Cl2N2O3S — CID 90513146
N-(2,5-dichlorophenyl)-1-methylsulfonylazetidine-3-carboxamide (PubChem CID 90513146) has the molecular formula C11H12Cl2N2O3S and a molecular weight of 323.20 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-1-methylsulfonylazetidine-3-carboxamide.
| Compound Name | N-(2,5-dichlorophenyl)-1-methylsulfonylazetidine-3-carboxamide |
|---|---|
| PubChem CID | 90513146 |
| Molecular Formula | C11H12Cl2N2O3S |
| Molecular Weight | 323.20 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | N-(2,5-dichlorophenyl)-1-methylsulfonylazetidine-3-carboxamide |
| SMILES | CS(=O)(=O)N1CC(C(=O)Nc2cc(Cl)ccc2Cl)C1 |
| InChI | InChI=1S/C11H12Cl2N2O3S/c1-19(17,18)15-5-7(6-15)11(16)14-10-4-8(12)2-3-9(10)13/h2-4,7H,5-6H2,1H3,(H,14,16) |
| InChIKey | DPORQDHJAXHGIU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.20 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |