C14H17ClN2O3S — CID 90513373
N-[(4-chlorophenyl)methyl]-1-cyclopropylsulfonylazetidine-3-carboxamide (PubChem CID 90513373) has the molecular formula C14H17ClN2O3S and a molecular weight of 328.82 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-1-cyclopropylsulfonylazetidine-3-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-1-cyclopropylsulfonylazetidine-3-carboxamide |
|---|---|
| PubChem CID | 90513373 |
| Molecular Formula | C14H17ClN2O3S |
| Molecular Weight | 328.82 g/mol |
| Exact Mass | 328.06 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-1-cyclopropylsulfonylazetidine-3-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)C1CN(S(=O)(=O)C2CC2)C1 |
| InChI | InChI=1S/C14H17ClN2O3S/c15-12-3-1-10(2-4-12)7-16-14(18)11-8-17(9-11)21(19,20)13-5-6-13/h1-4,11,13H,5-9H2,(H,16,18) |
| InChIKey | NBHVRJQGIHFWOQ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.82 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |