C17H13F2N3O4 — CID 90513691
1-(3,4-difluorobenzoyl)-N-(2-nitrophenyl)azetidine-3-carboxamide (PubChem CID 90513691) has the molecular formula C17H13F2N3O4 and a molecular weight of 361.30 g/mol. Its IUPAC name is 1-(3,4-difluorobenzoyl)-N-(2-nitrophenyl)azetidine-3-carboxamide.
| Compound Name | 1-(3,4-difluorobenzoyl)-N-(2-nitrophenyl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 90513691 |
| Molecular Formula | C17H13F2N3O4 |
| Molecular Weight | 361.30 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 1-(3,4-difluorobenzoyl)-N-(2-nitrophenyl)azetidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1[N+](=O)[O-])C1CN(C(=O)c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C17H13F2N3O4/c18-12-6-5-10(7-13(12)19)17(24)21-8-11(9-21)16(23)20-14-3-1-2-4-15(14)22(25)26/h1-7,11H,8-9H2,(H,20,23) |
| InChIKey | LJVXDORQVUQWLU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|