C23H27N7O2 — CID 90514499
N-(4-morpholin-4-ylphenyl)-1-(6-pyrazol-1-ylpyridazin-3-yl)piperidine-3-carboxamide (PubChem CID 90514499) has the molecular formula C23H27N7O2 and a molecular weight of 433.52 g/mol. Its IUPAC name is N-(4-morpholin-4-ylphenyl)-1-(6-pyrazol-1-ylpyridazin-3-yl)piperidine-3-carboxamide.
| Compound Name | N-(4-morpholin-4-ylphenyl)-1-(6-pyrazol-1-ylpyridazin-3-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 90514499 |
| Molecular Formula | C23H27N7O2 |
| Molecular Weight | 433.52 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | N-(4-morpholin-4-ylphenyl)-1-(6-pyrazol-1-ylpyridazin-3-yl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCOCC2)cc1)C1CCCN(c2ccc(-n3cccn3)nn2)C1 |
| InChI | InChI=1S/C23H27N7O2/c31-23(25-19-4-6-20(7-5-19)28-13-15-32-16-14-28)18-3-1-11-29(17-18)21-8-9-22(27-26-21)30-12-2-10-24-30/h2,4-10,12,18H,1,3,11,13-17H2,(H,25,31) |
| InChIKey | WJEZJCIRXFHGJO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.52 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|