C21H15F6N3O2 — CID 90515701
N-[2-(6-oxo-4-phenylpyrimidin-1-yl)ethyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 90515701) has the molecular formula C21H15F6N3O2 and a molecular weight of 455.36 g/mol. Its IUPAC name is N-[2-(6-oxo-4-phenylpyrimidin-1-yl)ethyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[2-(6-oxo-4-phenylpyrimidin-1-yl)ethyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 90515701 |
| Molecular Formula | C21H15F6N3O2 |
| Molecular Weight | 455.36 g/mol |
| Exact Mass | 455.11 |
| IUPAC Name | N-[2-(6-oxo-4-phenylpyrimidin-1-yl)ethyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | O=C(NCCn1cnc(-c2ccccc2)cc1=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H15F6N3O2/c22-20(23,24)15-8-14(9-16(10-15)21(25,26)27)19(32)28-6-7-30-12-29-17(11-18(30)31)13-4-2-1-3-5-13/h1-5,8-12H,6-7H2,(H,28,32) |
| InChIKey | WVJUSXFUGZDZIY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |