C21H20FN3O3 — CID 90515745
2-(4-fluorophenyl)-N-[2-[4-(4-methoxyphenyl)-6-oxopyrimidin-1-yl]ethyl]acetamide (PubChem CID 90515745) has the molecular formula C21H20FN3O3 and a molecular weight of 381.41 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[2-[4-(4-methoxyphenyl)-6-oxopyrimidin-1-yl]ethyl]acetamide.
| Compound Name | 2-(4-fluorophenyl)-N-[2-[4-(4-methoxyphenyl)-6-oxopyrimidin-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 90515745 |
| Molecular Formula | C21H20FN3O3 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[2-[4-(4-methoxyphenyl)-6-oxopyrimidin-1-yl]ethyl]acetamide |
| SMILES | COc1ccc(-c2cc(=O)n(CCNC(=O)Cc3ccc(F)cc3)cn2)cc1 |
| InChI | InChI=1S/C21H20FN3O3/c1-28-18-8-4-16(5-9-18)19-13-21(27)25(14-24-19)11-10-23-20(26)12-15-2-6-17(22)7-3-15/h2-9,13-14H,10-12H2,1H3,(H,23,26) |
| InChIKey | IEQVOGXJWKJGFN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |