C16H15N5O2S — CID 90517378
N-(3-methylsulfanylphenyl)-2-(6-oxo-3-pyrazol-1-ylpyridazin-1-yl)acetamide (PubChem CID 90517378) has the molecular formula C16H15N5O2S and a molecular weight of 341.40 g/mol. Its IUPAC name is N-(3-methylsulfanylphenyl)-2-(6-oxo-3-pyrazol-1-ylpyridazin-1-yl)acetamide.
| Compound Name | N-(3-methylsulfanylphenyl)-2-(6-oxo-3-pyrazol-1-ylpyridazin-1-yl)acetamide |
|---|---|
| PubChem CID | 90517378 |
| Molecular Formula | C16H15N5O2S |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | N-(3-methylsulfanylphenyl)-2-(6-oxo-3-pyrazol-1-ylpyridazin-1-yl)acetamide |
| SMILES | CSc1cccc(NC(=O)Cn2nc(-n3cccn3)ccc2=O)c1 |
| InChI | InChI=1S/C16H15N5O2S/c1-24-13-5-2-4-12(10-13)18-15(22)11-21-16(23)7-6-14(19-21)20-9-3-8-17-20/h2-10H,11H2,1H3,(H,18,22) |
| InChIKey | UYEVDANTNREQQX-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |