C22H28N6O2 — CID 90517883
N-[4-(diethylamino)phenyl]-2-[3-(3,5-dimethylpyrazol-1-yl)-6-oxopyridazin-1-yl]propanamide (PubChem CID 90517883) has the molecular formula C22H28N6O2 and a molecular weight of 408.51 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-2-[3-(3,5-dimethylpyrazol-1-yl)-6-oxopyridazin-1-yl]propanamide.
| Compound Name | N-[4-(diethylamino)phenyl]-2-[3-(3,5-dimethylpyrazol-1-yl)-6-oxopyridazin-1-yl]propanamide |
|---|---|
| PubChem CID | 90517883 |
| Molecular Formula | C22H28N6O2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-2-[3-(3,5-dimethylpyrazol-1-yl)-6-oxopyridazin-1-yl]propanamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C(C)n2nc(-n3nc(C)cc3C)ccc2=O)cc1 |
| InChI | InChI=1S/C22H28N6O2/c1-6-26(7-2)19-10-8-18(9-11-19)23-22(30)17(5)28-21(29)13-12-20(25-28)27-16(4)14-15(3)24-27/h8-14,17H,6-7H2,1-5H3,(H,23,30) |
| InChIKey | FDALXXZNTRWJEL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 85.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|