C19H21N3O5S2 — CID 90518508
2-(4-methoxyphenoxy)-N-[2-(6-oxo-3-thiophen-2-ylpyridazin-1-yl)ethyl]ethanesulfonamide (PubChem CID 90518508) has the molecular formula C19H21N3O5S2 and a molecular weight of 435.53 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)-N-[2-(6-oxo-3-thiophen-2-ylpyridazin-1-yl)ethyl]ethanesulfonamide.
| Compound Name | 2-(4-methoxyphenoxy)-N-[2-(6-oxo-3-thiophen-2-ylpyridazin-1-yl)ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 90518508 |
| Molecular Formula | C19H21N3O5S2 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.09 |
| IUPAC Name | 2-(4-methoxyphenoxy)-N-[2-(6-oxo-3-thiophen-2-ylpyridazin-1-yl)ethyl]ethanesulfonamide |
| SMILES | COc1ccc(OCCS(=O)(=O)NCCn2nc(-c3cccs3)ccc2=O)cc1 |
| InChI | InChI=1S/C19H21N3O5S2/c1-26-15-4-6-16(7-5-15)27-12-14-29(24,25)20-10-11-22-19(23)9-8-17(21-22)18-3-2-13-28-18/h2-9,13,20H,10-12,14H2,1H3 |
| InChIKey | QXUFCXPIILISCW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |