About 2-(4-fluorophenoxy)-N-(1,2-oxazol-3-yl)ethanesulfonamide
2-(4-fluorophenoxy)-N-(1,2-oxazol-3-yl)ethanesulfonamide (PubChem CID 90518632) has the molecular formula C11H11FN2O4S
and a molecular weight of 286.28 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-N-(1,2-oxazol-3-yl)ethanesulfonamide.
Molecular Properties
| Compound Name | 2-(4-fluorophenoxy)-N-(1,2-oxazol-3-yl)ethanesulfonamide |
| PubChem CID | 90518632 |
| Molecular Formula | C11H11FN2O4S |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 2-(4-fluorophenoxy)-N-(1,2-oxazol-3-yl)ethanesulfonamide |
| SMILES | O=S(=O)(CCOc1ccc(F)cc1)Nc1ccon1 |
| InChI | InChI=1S/C11H11FN2O4S/c12-9-1-3-10(4-2-9)17-7-8-19(15,16)14-11-5-6-18-13-11/h1-6H,7-8H2,(H,13,14) |
| InChIKey | BCCNEOBOBMLHMJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-fluorophenoxy)-N-(1,2-oxazol-3-yl)ethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorophenoxy)-N-(1,2-oxazol-3-yl)ethanesulfonamide?
The IUPAC name of 2-(4-fluorophenoxy)-N-(1,2-oxazol-3-yl)ethanesulfonamide (CID 90518632) is 2-(4-fluorophenoxy)-N-(1,2-oxazol-3-yl)ethanesulfonamide.
What is the SMILES notation for 2-(4-fluorophenoxy)-N-(1,2-oxazol-3-yl)ethanesulfonamide?
The canonical SMILES for 2-(4-fluorophenoxy)-N-(1,2-oxazol-3-yl)ethanesulfonamide is O=S(=O)(CCOc1ccc(F)cc1)Nc1ccon1.
What is the InChIKey of 2-(4-fluorophenoxy)-N-(1,2-oxazol-3-yl)ethanesulfonamide?
The InChIKey is BCCNEOBOBMLHMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FN2O4S/c12-9-1-3-10(4-2-9)17-7-8-19(15,16)14-11-5-6-18-13-11/h1-6H,7-8H2,(H,13,14).
What are the key properties of 2-(4-fluorophenoxy)-N-(1,2-oxazol-3-yl)ethanesulfonamide?
2-(4-fluorophenoxy)-N-(1,2-oxazol-3-yl)ethanesulfonamide has a molecular weight of 286.28 g/mol, XLogP of 1.63, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorophenoxy)-N-(1,2-oxazol-3-yl)ethanesulfonamide is sourced from PubChem (CID 90518632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).