C20H19BrN2OS — CID 9051902
N-(2-bromophenyl)-2-[[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]amino]acetamide (PubChem CID 9051902) has the molecular formula C20H19BrN2OS and a molecular weight of 415.36 g/mol. Its IUPAC name is N-(2-bromophenyl)-2-[[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]amino]acetamide.
| Compound Name | N-(2-bromophenyl)-2-[[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]amino]acetamide |
|---|---|
| PubChem CID | 9051902 |
| Molecular Formula | C20H19BrN2OS |
| Molecular Weight | 415.36 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | N-(2-bromophenyl)-2-[[(S)-(4-methylphenyl)-thiophen-2-ylmethyl]amino]acetamide |
| SMILES | Cc1ccc([C@H](NCC(=O)Nc2ccccc2Br)c2cccs2)cc1 |
| InChI | InChI=1S/C20H19BrN2OS/c1-14-8-10-15(11-9-14)20(18-7-4-12-25-18)22-13-19(24)23-17-6-3-2-5-16(17)21/h2-12,20,22H,13H2,1H3,(H,23,24)/t20-/m0/s1 |
| InChIKey | USZLUVNIAROXLA-FQEVSTJZSA-N |
| XLogP | 5.14 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.36 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |