C16H16N8O3S — CID 90520530
N-(5-nitro-1,3-thiazol-2-yl)-1-(6-pyrazol-1-ylpyrimidin-4-yl)piperidine-3-carboxamide (PubChem CID 90520530) has the molecular formula C16H16N8O3S and a molecular weight of 400.42 g/mol. Its IUPAC name is N-(5-nitro-1,3-thiazol-2-yl)-1-(6-pyrazol-1-ylpyrimidin-4-yl)piperidine-3-carboxamide.
| Compound Name | N-(5-nitro-1,3-thiazol-2-yl)-1-(6-pyrazol-1-ylpyrimidin-4-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 90520530 |
| Molecular Formula | C16H16N8O3S |
| Molecular Weight | 400.42 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | N-(5-nitro-1,3-thiazol-2-yl)-1-(6-pyrazol-1-ylpyrimidin-4-yl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ncc([N+](=O)[O-])s1)C1CCCN(c2cc(-n3cccn3)ncn2)C1 |
| InChI | InChI=1S/C16H16N8O3S/c25-15(21-16-17-8-14(28-16)24(26)27)11-3-1-5-22(9-11)12-7-13(19-10-18-12)23-6-2-4-20-23/h2,4,6-8,10-11H,1,3,5,9H2,(H,17,21,25) |
| InChIKey | XZMRHUGRYFUJTG-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 131.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|