C16H19N3O3S2 — CID 90521136
N-[[1-(pyridine-3-carbonyl)piperidin-4-yl]methyl]thiophene-2-sulfonamide (PubChem CID 90521136) has the molecular formula C16H19N3O3S2 and a molecular weight of 365.48 g/mol. Its IUPAC name is N-[[1-(pyridine-3-carbonyl)piperidin-4-yl]methyl]thiophene-2-sulfonamide.
| Compound Name | N-[[1-(pyridine-3-carbonyl)piperidin-4-yl]methyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 90521136 |
| Molecular Formula | C16H19N3O3S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | N-[[1-(pyridine-3-carbonyl)piperidin-4-yl]methyl]thiophene-2-sulfonamide |
| SMILES | O=C(c1cccnc1)N1CCC(CNS(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C16H19N3O3S2/c20-16(14-3-1-7-17-12-14)19-8-5-13(6-9-19)11-18-24(21,22)15-4-2-10-23-15/h1-4,7,10,12-13,18H,5-6,8-9,11H2 |
| InChIKey | LWNGSVVWMHBVPZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |