C13H18N2O3S — CID 90523165
N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-N'-phenyloxamide (PubChem CID 90523165) has the molecular formula C13H18N2O3S and a molecular weight of 282.36 g/mol. Its IUPAC name is N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-N'-phenyloxamide.
| Compound Name | N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-N'-phenyloxamide |
|---|---|
| PubChem CID | 90523165 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | N-(2-hydroxy-2-methyl-3-methylsulfanylpropyl)-N'-phenyloxamide |
| SMILES | CSCC(C)(O)CNC(=O)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C13H18N2O3S/c1-13(18,9-19-2)8-14-11(16)12(17)15-10-6-4-3-5-7-10/h3-7,18H,8-9H2,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | LNOHIPNJSKUIAF-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|