About 1-bromo-N-(3-hydroxy-4,4-dimethylpentyl)methanesulfonamide
1-bromo-N-(3-hydroxy-4,4-dimethylpentyl)methanesulfonamide (PubChem CID 90523471) has the molecular formula C8H18BrNO3S
and a molecular weight of 288.21 g/mol. Its IUPAC name is 1-bromo-N-(3-hydroxy-4,4-dimethylpentyl)methanesulfonamide.
Molecular Properties
| Compound Name | 1-bromo-N-(3-hydroxy-4,4-dimethylpentyl)methanesulfonamide |
| PubChem CID | 90523471 |
| Molecular Formula | C8H18BrNO3S |
| Molecular Weight | 288.21 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 1-bromo-N-(3-hydroxy-4,4-dimethylpentyl)methanesulfonamide |
| SMILES | CC(C)(C)C(O)CCNS(=O)(=O)CBr |
| InChI | InChI=1S/C8H18BrNO3S/c1-8(2,3)7(11)4-5-10-14(12,13)6-9/h7,10-11H,4-6H2,1-3H3 |
| InChIKey | NMXUBGVHKZUSJQ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-N-(3-hydroxy-4,4-dimethylpentyl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-N-(3-hydroxy-4,4-dimethylpentyl)methanesulfonamide?
The IUPAC name of 1-bromo-N-(3-hydroxy-4,4-dimethylpentyl)methanesulfonamide (CID 90523471) is 1-bromo-N-(3-hydroxy-4,4-dimethylpentyl)methanesulfonamide.
What is the SMILES notation for 1-bromo-N-(3-hydroxy-4,4-dimethylpentyl)methanesulfonamide?
The canonical SMILES for 1-bromo-N-(3-hydroxy-4,4-dimethylpentyl)methanesulfonamide is CC(C)(C)C(O)CCNS(=O)(=O)CBr.
What is the InChIKey of 1-bromo-N-(3-hydroxy-4,4-dimethylpentyl)methanesulfonamide?
The InChIKey is NMXUBGVHKZUSJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18BrNO3S/c1-8(2,3)7(11)4-5-10-14(12,13)6-9/h7,10-11H,4-6H2,1-3H3.
What are the key properties of 1-bromo-N-(3-hydroxy-4,4-dimethylpentyl)methanesulfonamide?
1-bromo-N-(3-hydroxy-4,4-dimethylpentyl)methanesulfonamide has a molecular weight of 288.21 g/mol, XLogP of 1.06, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-N-(3-hydroxy-4,4-dimethylpentyl)methanesulfonamide is sourced from PubChem (CID 90523471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).