C20H21NO3S — CID 90524106
2-ethoxy-N-(3-hydroxy-3-thiophen-2-ylpropyl)naphthalene-1-carboxamide (PubChem CID 90524106) has the molecular formula C20H21NO3S and a molecular weight of 355.46 g/mol. Its IUPAC name is 2-ethoxy-N-(3-hydroxy-3-thiophen-2-ylpropyl)naphthalene-1-carboxamide.
| Compound Name | 2-ethoxy-N-(3-hydroxy-3-thiophen-2-ylpropyl)naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 90524106 |
| Molecular Formula | C20H21NO3S |
| Molecular Weight | 355.46 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 2-ethoxy-N-(3-hydroxy-3-thiophen-2-ylpropyl)naphthalene-1-carboxamide |
| SMILES | CCOc1ccc2ccccc2c1C(=O)NCCC(O)c1cccs1 |
| InChI | InChI=1S/C20H21NO3S/c1-2-24-17-10-9-14-6-3-4-7-15(14)19(17)20(23)21-12-11-16(22)18-8-5-13-25-18/h3-10,13,16,22H,2,11-12H2,1H3,(H,21,23) |
| InChIKey | HJEDRPFNBUYUAM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.46 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |