C14H17NO4S2 — CID 90524151
N-(3-hydroxy-3-thiophen-2-ylpropyl)-4-methoxybenzenesulfonamide (PubChem CID 90524151) has the molecular formula C14H17NO4S2 and a molecular weight of 327.43 g/mol. Its IUPAC name is N-(3-hydroxy-3-thiophen-2-ylpropyl)-4-methoxybenzenesulfonamide.
| Compound Name | N-(3-hydroxy-3-thiophen-2-ylpropyl)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 90524151 |
| Molecular Formula | C14H17NO4S2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | N-(3-hydroxy-3-thiophen-2-ylpropyl)-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCC(O)c2cccs2)cc1 |
| InChI | InChI=1S/C14H17NO4S2/c1-19-11-4-6-12(7-5-11)21(17,18)15-9-8-13(16)14-3-2-10-20-14/h2-7,10,13,15-16H,8-9H2,1H3 |
| InChIKey | DWWAVWGHPUXRGG-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |