C21H22N4O6S — CID 90526747
2-(furan-2-carbonylamino)-N-(3,4,5-trimethoxyphenyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxamide (PubChem CID 90526747) has the molecular formula C21H22N4O6S and a molecular weight of 458.50 g/mol. Its IUPAC name is 2-(furan-2-carbonylamino)-N-(3,4,5-trimethoxyphenyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxamide.
| Compound Name | 2-(furan-2-carbonylamino)-N-(3,4,5-trimethoxyphenyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 90526747 |
| Molecular Formula | C21H22N4O6S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | 2-(furan-2-carbonylamino)-N-(3,4,5-trimethoxyphenyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carboxamide |
| SMILES | COc1cc(NC(=O)N2CCc3nc(NC(=O)c4ccco4)sc3C2)cc(OC)c1OC |
| InChI | InChI=1S/C21H22N4O6S/c1-28-15-9-12(10-16(29-2)18(15)30-3)22-21(27)25-7-6-13-17(11-25)32-20(23-13)24-19(26)14-5-4-8-31-14/h4-5,8-10H,6-7,11H2,1-3H3,(H,22,27)(H,23,24,26) |
| InChIKey | WLTCWLMCCIAWNL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 115.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |