C19H17N7O4S — CID 90527589
N-[5-[2-(4-nitroanilino)-2-oxoethyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]pyrazine-2-carboxamide (PubChem CID 90527589) has the molecular formula C19H17N7O4S and a molecular weight of 439.46 g/mol. Its IUPAC name is N-[5-[2-(4-nitroanilino)-2-oxoethyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]pyrazine-2-carboxamide.
| Compound Name | N-[5-[2-(4-nitroanilino)-2-oxoethyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 90527589 |
| Molecular Formula | C19H17N7O4S |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | N-[5-[2-(4-nitroanilino)-2-oxoethyl]-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]pyrazine-2-carboxamide |
| SMILES | O=C(CN1CCc2nc(NC(=O)c3cnccn3)sc2C1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H17N7O4S/c27-17(22-12-1-3-13(4-2-12)26(29)30)11-25-8-5-14-16(10-25)31-19(23-14)24-18(28)15-9-20-6-7-21-15/h1-4,6-7,9H,5,8,10-11H2,(H,22,27)(H,23,24,28) |
| InChIKey | FMOJTOIKNYANJR-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 143.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|