C23H32N4O5S — CID 90529826
1-propan-2-yl-3-[5-(3,4,5-triethoxybenzoyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]urea (PubChem CID 90529826) has the molecular formula C23H32N4O5S and a molecular weight of 476.60 g/mol. Its IUPAC name is 1-propan-2-yl-3-[5-(3,4,5-triethoxybenzoyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]urea.
| Compound Name | 1-propan-2-yl-3-[5-(3,4,5-triethoxybenzoyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]urea |
|---|---|
| PubChem CID | 90529826 |
| Molecular Formula | C23H32N4O5S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | 1-propan-2-yl-3-[5-(3,4,5-triethoxybenzoyl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]urea |
| SMILES | CCOc1cc(C(=O)N2CCc3nc(NC(=O)NC(C)C)sc3C2)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H32N4O5S/c1-6-30-17-11-15(12-18(31-7-2)20(17)32-8-3)21(28)27-10-9-16-19(13-27)33-23(25-16)26-22(29)24-14(4)5/h11-12,14H,6-10,13H2,1-5H3,(H2,24,25,26,29) |
| InChIKey | GEDOJYRCAUXGCZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |