C20H21N3O3S3 — CID 90532286
N-[5-(2,4,6-trimethylphenyl)sulfonyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]thiophene-3-carboxamide (PubChem CID 90532286) has the molecular formula C20H21N3O3S3 and a molecular weight of 447.61 g/mol. Its IUPAC name is N-[5-(2,4,6-trimethylphenyl)sulfonyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]thiophene-3-carboxamide.
| Compound Name | N-[5-(2,4,6-trimethylphenyl)sulfonyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 90532286 |
| Molecular Formula | C20H21N3O3S3 |
| Molecular Weight | 447.61 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | N-[5-(2,4,6-trimethylphenyl)sulfonyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridin-2-yl]thiophene-3-carboxamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCc3nc(NC(=O)c4ccsc4)sc3C2)c(C)c1 |
| InChI | InChI=1S/C20H21N3O3S3/c1-12-8-13(2)18(14(3)9-12)29(25,26)23-6-4-16-17(10-23)28-20(21-16)22-19(24)15-5-7-27-11-15/h5,7-9,11H,4,6,10H2,1-3H3,(H,21,22,24) |
| InChIKey | SLZJLCYAYPGFPQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.61 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |