C18H22N2O5 — CID 90534141
4-(1,3-dioxoisoindol-2-yl)-N-[(4-hydroxyoxan-4-yl)methyl]butanamide (PubChem CID 90534141) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-[(4-hydroxyoxan-4-yl)methyl]butanamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-[(4-hydroxyoxan-4-yl)methyl]butanamide |
|---|---|
| PubChem CID | 90534141 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-[(4-hydroxyoxan-4-yl)methyl]butanamide |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)NCC1(O)CCOCC1 |
| InChI | InChI=1S/C18H22N2O5/c21-15(19-12-18(24)7-10-25-11-8-18)6-3-9-20-16(22)13-4-1-2-5-14(13)17(20)23/h1-2,4-5,24H,3,6-12H2,(H,19,21) |
| InChIKey | XMNRKAGRMAGMPN-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|