C15H18N2O4 — CID 90534330
2-(2,5-dioxopyrrolidin-1-yl)-N-(2-hydroxy-3-phenylpropyl)acetamide (PubChem CID 90534330) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrolidin-1-yl)-N-(2-hydroxy-3-phenylpropyl)acetamide.
| Compound Name | 2-(2,5-dioxopyrrolidin-1-yl)-N-(2-hydroxy-3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 90534330 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 2-(2,5-dioxopyrrolidin-1-yl)-N-(2-hydroxy-3-phenylpropyl)acetamide |
| SMILES | O=C(CN1C(=O)CCC1=O)NCC(O)Cc1ccccc1 |
| InChI | InChI=1S/C15H18N2O4/c18-12(8-11-4-2-1-3-5-11)9-16-13(19)10-17-14(20)6-7-15(17)21/h1-5,12,18H,6-10H2,(H,16,19) |
| InChIKey | YBYKHGAJCYDLSI-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|