C18H20N2O6 — CID 90534423
N-(2-hydroxy-3-phenylpropyl)-4,5-dimethoxy-2-nitrobenzamide (PubChem CID 90534423) has the molecular formula C18H20N2O6 and a molecular weight of 360.37 g/mol. Its IUPAC name is N-(2-hydroxy-3-phenylpropyl)-4,5-dimethoxy-2-nitrobenzamide.
| Compound Name | N-(2-hydroxy-3-phenylpropyl)-4,5-dimethoxy-2-nitrobenzamide |
|---|---|
| PubChem CID | 90534423 |
| Molecular Formula | C18H20N2O6 |
| Molecular Weight | 360.37 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | N-(2-hydroxy-3-phenylpropyl)-4,5-dimethoxy-2-nitrobenzamide |
| SMILES | COc1cc(C(=O)NCC(O)Cc2ccccc2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H20N2O6/c1-25-16-9-14(15(20(23)24)10-17(16)26-2)18(22)19-11-13(21)8-12-6-4-3-5-7-12/h3-7,9-10,13,21H,8,11H2,1-2H3,(H,19,22) |
| InChIKey | ATRGULKLPOZZHO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.37 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|