C20H18N4O2 — CID 90535046
N-[2-hydroxy-2-(1-methylindol-3-yl)ethyl]quinoxaline-2-carboxamide (PubChem CID 90535046) has the molecular formula C20H18N4O2 and a molecular weight of 346.39 g/mol. Its IUPAC name is N-[2-hydroxy-2-(1-methylindol-3-yl)ethyl]quinoxaline-2-carboxamide.
| Compound Name | N-[2-hydroxy-2-(1-methylindol-3-yl)ethyl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 90535046 |
| Molecular Formula | C20H18N4O2 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | N-[2-hydroxy-2-(1-methylindol-3-yl)ethyl]quinoxaline-2-carboxamide |
| SMILES | Cn1cc(C(O)CNC(=O)c2cnc3ccccc3n2)c2ccccc21 |
| InChI | InChI=1S/C20H18N4O2/c1-24-12-14(13-6-2-5-9-18(13)24)19(25)11-22-20(26)17-10-21-15-7-3-4-8-16(15)23-17/h2-10,12,19,25H,11H2,1H3,(H,22,26) |
| InChIKey | GKCOHASTUWPFSQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |