C17H17FN2O3S — CID 90535149
4-fluoro-N-[2-hydroxy-2-(1-methylindol-3-yl)ethyl]benzenesulfonamide (PubChem CID 90535149) has the molecular formula C17H17FN2O3S and a molecular weight of 348.40 g/mol. Its IUPAC name is 4-fluoro-N-[2-hydroxy-2-(1-methylindol-3-yl)ethyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[2-hydroxy-2-(1-methylindol-3-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 90535149 |
| Molecular Formula | C17H17FN2O3S |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 4-fluoro-N-[2-hydroxy-2-(1-methylindol-3-yl)ethyl]benzenesulfonamide |
| SMILES | Cn1cc(C(O)CNS(=O)(=O)c2ccc(F)cc2)c2ccccc21 |
| InChI | InChI=1S/C17H17FN2O3S/c1-20-11-15(14-4-2-3-5-16(14)20)17(21)10-19-24(22,23)13-8-6-12(18)7-9-13/h2-9,11,17,19,21H,10H2,1H3 |
| InChIKey | ZQCPUVJVULTLHK-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |