C21H21NO3S — CID 90535526
N-(2-cyclopropyl-2-hydroxy-2-phenylethyl)naphthalene-2-sulfonamide (PubChem CID 90535526) has the molecular formula C21H21NO3S and a molecular weight of 367.47 g/mol. Its IUPAC name is N-(2-cyclopropyl-2-hydroxy-2-phenylethyl)naphthalene-2-sulfonamide.
| Compound Name | N-(2-cyclopropyl-2-hydroxy-2-phenylethyl)naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 90535526 |
| Molecular Formula | C21H21NO3S |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | N-(2-cyclopropyl-2-hydroxy-2-phenylethyl)naphthalene-2-sulfonamide |
| SMILES | O=S(=O)(NCC(O)(c1ccccc1)C1CC1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H21NO3S/c23-21(19-11-12-19,18-8-2-1-3-9-18)15-22-26(24,25)20-13-10-16-6-4-5-7-17(16)14-20/h1-10,13-14,19,22-23H,11-12,15H2 |
| InChIKey | BHTOWWQVIAXQJK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |