C17H24N2O3 — CID 90535558
N'-(2-cyclopropyl-2-hydroxy-2-phenylethyl)-N-(2-methylpropyl)oxamide (PubChem CID 90535558) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is N'-(2-cyclopropyl-2-hydroxy-2-phenylethyl)-N-(2-methylpropyl)oxamide.
| Compound Name | N'-(2-cyclopropyl-2-hydroxy-2-phenylethyl)-N-(2-methylpropyl)oxamide |
|---|---|
| PubChem CID | 90535558 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | N'-(2-cyclopropyl-2-hydroxy-2-phenylethyl)-N-(2-methylpropyl)oxamide |
| SMILES | CC(C)CNC(=O)C(=O)NCC(O)(c1ccccc1)C1CC1 |
| InChI | InChI=1S/C17H24N2O3/c1-12(2)10-18-15(20)16(21)19-11-17(22,14-8-9-14)13-6-4-3-5-7-13/h3-7,12,14,22H,8-11H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | BATBLBNFOZYDSX-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|