About N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]benzenesulfonamide
N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]benzenesulfonamide (PubChem CID 90535802) has the molecular formula C16H17NO4S
and a molecular weight of 319.38 g/mol. Its IUPAC name is N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]benzenesulfonamide.
Molecular Properties
| Compound Name | N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]benzenesulfonamide |
| PubChem CID | 90535802 |
| Molecular Formula | C16H17NO4S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC1(O)CCOc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C16H17NO4S/c18-16(10-11-21-15-9-5-4-8-14(15)16)12-17-22(19,20)13-6-2-1-3-7-13/h1-9,17-18H,10-12H2 |
| InChIKey | OIRJDWLZISQSST-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]benzenesulfonamide?
The IUPAC name of N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]benzenesulfonamide (CID 90535802) is N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]benzenesulfonamide.
What is the SMILES notation for N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]benzenesulfonamide?
The canonical SMILES for N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]benzenesulfonamide is O=S(=O)(NCC1(O)CCOc2ccccc21)c1ccccc1.
What is the InChIKey of N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]benzenesulfonamide?
The InChIKey is OIRJDWLZISQSST-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO4S/c18-16(10-11-21-15-9-5-4-8-14(15)16)12-17-22(19,20)13-6-2-1-3-7-13/h1-9,17-18H,10-12H2.
What are the key properties of N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]benzenesulfonamide?
N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]benzenesulfonamide has a molecular weight of 319.38 g/mol, XLogP of 1.64, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-hydroxy-2,3-dihydrochromen-4-yl)methyl]benzenesulfonamide is sourced from PubChem (CID 90535802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).