About N'-[(2,5-dimethylfuran-3-yl)methyl]-N-propyloxamide
N'-[(2,5-dimethylfuran-3-yl)methyl]-N-propyloxamide (PubChem CID 90536222) has the molecular formula C12H18N2O3
and a molecular weight of 238.29 g/mol. Its IUPAC name is N'-[(2,5-dimethylfuran-3-yl)methyl]-N-propyloxamide.
Molecular Properties
| Compound Name | N'-[(2,5-dimethylfuran-3-yl)methyl]-N-propyloxamide |
| PubChem CID | 90536222 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | N'-[(2,5-dimethylfuran-3-yl)methyl]-N-propyloxamide |
| SMILES | CCCNC(=O)C(=O)NCc1cc(C)oc1C |
| InChI | InChI=1S/C12H18N2O3/c1-4-5-13-11(15)12(16)14-7-10-6-8(2)17-9(10)3/h6H,4-5,7H2,1-3H3,(H,13,15)(H,14,16) |
| InChIKey | BQDKWROMZBQLTB-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-[(2,5-dimethylfuran-3-yl)methyl]-N-propyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(2,5-dimethylfuran-3-yl)methyl]-N-propyloxamide?
The IUPAC name of N'-[(2,5-dimethylfuran-3-yl)methyl]-N-propyloxamide (CID 90536222) is N'-[(2,5-dimethylfuran-3-yl)methyl]-N-propyloxamide.
What is the SMILES notation for N'-[(2,5-dimethylfuran-3-yl)methyl]-N-propyloxamide?
The canonical SMILES for N'-[(2,5-dimethylfuran-3-yl)methyl]-N-propyloxamide is CCCNC(=O)C(=O)NCc1cc(C)oc1C.
What is the InChIKey of N'-[(2,5-dimethylfuran-3-yl)methyl]-N-propyloxamide?
The InChIKey is BQDKWROMZBQLTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O3/c1-4-5-13-11(15)12(16)14-7-10-6-8(2)17-9(10)3/h6H,4-5,7H2,1-3H3,(H,13,15)(H,14,16).
What are the key properties of N'-[(2,5-dimethylfuran-3-yl)methyl]-N-propyloxamide?
N'-[(2,5-dimethylfuran-3-yl)methyl]-N-propyloxamide has a molecular weight of 238.29 g/mol, XLogP of 1.04, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(2,5-dimethylfuran-3-yl)methyl]-N-propyloxamide is sourced from PubChem (CID 90536222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).