About 2-ethylsulfonyl-7,7-dimethyl-6,8-dioxa-2-azaspiro[3.5]nonane
2-ethylsulfonyl-7,7-dimethyl-6,8-dioxa-2-azaspiro[3.5]nonane (PubChem CID 90537488) has the molecular formula C10H19NO4S
and a molecular weight of 249.33 g/mol. Its IUPAC name is 2-ethylsulfonyl-7,7-dimethyl-6,8-dioxa-2-azaspiro[3.5]nonane.
Molecular Properties
| Compound Name | 2-ethylsulfonyl-7,7-dimethyl-6,8-dioxa-2-azaspiro[3.5]nonane |
| PubChem CID | 90537488 |
| Molecular Formula | C10H19NO4S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2-ethylsulfonyl-7,7-dimethyl-6,8-dioxa-2-azaspiro[3.5]nonane |
| SMILES | CCS(=O)(=O)N1CC2(COC(C)(C)OC2)C1 |
| InChI | InChI=1S/C10H19NO4S/c1-4-16(12,13)11-5-10(6-11)7-14-9(2,3)15-8-10/h4-8H2,1-3H3 |
| InChIKey | OOHBKLCYVACCGE-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethylsulfonyl-7,7-dimethyl-6,8-dioxa-2-azaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfonyl-7,7-dimethyl-6,8-dioxa-2-azaspiro[3.5]nonane?
The IUPAC name of 2-ethylsulfonyl-7,7-dimethyl-6,8-dioxa-2-azaspiro[3.5]nonane (CID 90537488) is 2-ethylsulfonyl-7,7-dimethyl-6,8-dioxa-2-azaspiro[3.5]nonane.
What is the SMILES notation for 2-ethylsulfonyl-7,7-dimethyl-6,8-dioxa-2-azaspiro[3.5]nonane?
The canonical SMILES for 2-ethylsulfonyl-7,7-dimethyl-6,8-dioxa-2-azaspiro[3.5]nonane is CCS(=O)(=O)N1CC2(COC(C)(C)OC2)C1.
What is the InChIKey of 2-ethylsulfonyl-7,7-dimethyl-6,8-dioxa-2-azaspiro[3.5]nonane?
The InChIKey is OOHBKLCYVACCGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO4S/c1-4-16(12,13)11-5-10(6-11)7-14-9(2,3)15-8-10/h4-8H2,1-3H3.
What are the key properties of 2-ethylsulfonyl-7,7-dimethyl-6,8-dioxa-2-azaspiro[3.5]nonane?
2-ethylsulfonyl-7,7-dimethyl-6,8-dioxa-2-azaspiro[3.5]nonane has a molecular weight of 249.33 g/mol, XLogP of 0.42, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfonyl-7,7-dimethyl-6,8-dioxa-2-azaspiro[3.5]nonane is sourced from PubChem (CID 90537488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).