C16H18ClNO — CID 90537906
N-but-3-ynyl-1-(4-chlorophenyl)cyclopentane-1-carboxamide (PubChem CID 90537906) has the molecular formula C16H18ClNO and a molecular weight of 275.78 g/mol. Its IUPAC name is N-but-3-ynyl-1-(4-chlorophenyl)cyclopentane-1-carboxamide.
| Compound Name | N-but-3-ynyl-1-(4-chlorophenyl)cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 90537906 |
| Molecular Formula | C16H18ClNO |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | N-but-3-ynyl-1-(4-chlorophenyl)cyclopentane-1-carboxamide |
| SMILES | C#CCCNC(=O)C1(c2ccc(Cl)cc2)CCCC1 |
| InChI | InChI=1S/C16H18ClNO/c1-2-3-12-18-15(19)16(10-4-5-11-16)13-6-8-14(17)9-7-13/h1,6-9H,3-5,10-12H2,(H,18,19) |
| InChIKey | XVLGVQXSYVENDM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|