C15H13F3N4O4 — CID 90539870
(4-nitrophenyl)-[4-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]piperidin-1-yl]methanone (PubChem CID 90539870) has the molecular formula C15H13F3N4O4 and a molecular weight of 370.29 g/mol. Its IUPAC name is (4-nitrophenyl)-[4-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]piperidin-1-yl]methanone.
| Compound Name | (4-nitrophenyl)-[4-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 90539870 |
| Molecular Formula | C15H13F3N4O4 |
| Molecular Weight | 370.29 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | (4-nitrophenyl)-[4-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)N1CCC(c2nnc(C(F)(F)F)o2)CC1 |
| InChI | InChI=1S/C15H13F3N4O4/c16-15(17,18)14-20-19-12(26-14)9-5-7-21(8-6-9)13(23)10-1-3-11(4-2-10)22(24)25/h1-4,9H,5-8H2 |
| InChIKey | CUTNTRQYEMYHHR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 102.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|