C25H24N4O5 — CID 90541012
5-[1-(8-methoxy-2-oxochromene-3-carbonyl)piperidin-3-yl]-2-methyl-4-phenyl-1,2,4-triazol-3-one (PubChem CID 90541012) has the molecular formula C25H24N4O5 and a molecular weight of 460.49 g/mol. Its IUPAC name is 5-[1-(8-methoxy-2-oxochromene-3-carbonyl)piperidin-3-yl]-2-methyl-4-phenyl-1,2,4-triazol-3-one.
| Compound Name | 5-[1-(8-methoxy-2-oxochromene-3-carbonyl)piperidin-3-yl]-2-methyl-4-phenyl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 90541012 |
| Molecular Formula | C25H24N4O5 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 5-[1-(8-methoxy-2-oxochromene-3-carbonyl)piperidin-3-yl]-2-methyl-4-phenyl-1,2,4-triazol-3-one |
| SMILES | COc1cccc2cc(C(=O)N3CCCC(c4nn(C)c(=O)n4-c4ccccc4)C3)c(=O)oc12 |
| InChI | InChI=1S/C25H24N4O5/c1-27-25(32)29(18-10-4-3-5-11-18)22(26-27)17-9-7-13-28(15-17)23(30)19-14-16-8-6-12-20(33-2)21(16)34-24(19)31/h3-6,8,10-12,14,17H,7,9,13,15H2,1-2H3 |
| InChIKey | HKXGVQAIHXYKSA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 99.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|