C13H11ClF3N5O4 — CID 90541476
2-chloro-N-[2-[4-methyl-5-oxo-3-(trifluoromethyl)-1,2,4-triazol-1-yl]ethyl]-5-nitrobenzamide (PubChem CID 90541476) has the molecular formula C13H11ClF3N5O4 and a molecular weight of 393.71 g/mol. Its IUPAC name is 2-chloro-N-[2-[4-methyl-5-oxo-3-(trifluoromethyl)-1,2,4-triazol-1-yl]ethyl]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[2-[4-methyl-5-oxo-3-(trifluoromethyl)-1,2,4-triazol-1-yl]ethyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 90541476 |
| Molecular Formula | C13H11ClF3N5O4 |
| Molecular Weight | 393.71 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | 2-chloro-N-[2-[4-methyl-5-oxo-3-(trifluoromethyl)-1,2,4-triazol-1-yl]ethyl]-5-nitrobenzamide |
| SMILES | Cn1c(C(F)(F)F)nn(CCNC(=O)c2cc([N+](=O)[O-])ccc2Cl)c1=O |
| InChI | InChI=1S/C13H11ClF3N5O4/c1-20-11(13(15,16)17)19-21(12(20)24)5-4-18-10(23)8-6-7(22(25)26)2-3-9(8)14/h2-3,6H,4-5H2,1H3,(H,18,23) |
| InChIKey | GZJCGCYGEPSXMP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 112.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.71 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|