C17H26N4O4 — CID 90542992
ethyl 4-[4-(4-cyclopropyl-1-methyl-5-oxo-1,2,4-triazol-3-yl)piperidin-1-yl]-3-oxobutanoate (PubChem CID 90542992) has the molecular formula C17H26N4O4 and a molecular weight of 350.42 g/mol. Its IUPAC name is ethyl 4-[4-(4-cyclopropyl-1-methyl-5-oxo-1,2,4-triazol-3-yl)piperidin-1-yl]-3-oxobutanoate.
| Compound Name | ethyl 4-[4-(4-cyclopropyl-1-methyl-5-oxo-1,2,4-triazol-3-yl)piperidin-1-yl]-3-oxobutanoate |
|---|---|
| PubChem CID | 90542992 |
| Molecular Formula | C17H26N4O4 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | ethyl 4-[4-(4-cyclopropyl-1-methyl-5-oxo-1,2,4-triazol-3-yl)piperidin-1-yl]-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)CN1CCC(c2nn(C)c(=O)n2C2CC2)CC1 |
| InChI | InChI=1S/C17H26N4O4/c1-3-25-15(23)10-14(22)11-20-8-6-12(7-9-20)16-18-19(2)17(24)21(16)13-4-5-13/h12-13H,3-11H2,1-2H3 |
| InChIKey | TULDUWYBSFNFIB-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 86.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|