C20H24N6O2 — CID 90546179
3-methoxy-2-methyl-N-[6-(4-methylpiperidin-1-yl)pyrimidin-4-yl]indazole-6-carboxamide (PubChem CID 90546179) has the molecular formula C20H24N6O2 and a molecular weight of 380.45 g/mol. Its IUPAC name is 3-methoxy-2-methyl-N-[6-(4-methylpiperidin-1-yl)pyrimidin-4-yl]indazole-6-carboxamide.
| Compound Name | 3-methoxy-2-methyl-N-[6-(4-methylpiperidin-1-yl)pyrimidin-4-yl]indazole-6-carboxamide |
|---|---|
| PubChem CID | 90546179 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 3-methoxy-2-methyl-N-[6-(4-methylpiperidin-1-yl)pyrimidin-4-yl]indazole-6-carboxamide |
| SMILES | COc1c2ccc(C(=O)Nc3cc(N4CCC(C)CC4)ncn3)cc2nn1C |
| InChI | InChI=1S/C20H24N6O2/c1-13-6-8-26(9-7-13)18-11-17(21-12-22-18)23-19(27)14-4-5-15-16(10-14)24-25(2)20(15)28-3/h4-5,10-13H,6-9H2,1-3H3,(H,21,22,23,27) |
| InChIKey | KXFFYWCUQKLDBF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |