About N-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]adamantane-1-carboxamide
N-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]adamantane-1-carboxamide (PubChem CID 90546468) has the molecular formula C22H26N2OS
and a molecular weight of 366.53 g/mol. Its IUPAC name is N-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]adamantane-1-carboxamide.
Molecular Properties
| Compound Name | N-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]adamantane-1-carboxamide |
| PubChem CID | 90546468 |
| Molecular Formula | C22H26N2OS |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | N-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]adamantane-1-carboxamide |
| SMILES | Cc1nc(-c2ccccc2)sc1CNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H26N2OS/c1-14-19(26-20(24-14)18-5-3-2-4-6-18)13-23-21(25)22-10-15-7-16(11-22)9-17(8-15)12-22/h2-6,15-17H,7-13H2,1H3,(H,23,25) |
| InChIKey | WBBVYUNAGPTBAL-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]adamantane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]adamantane-1-carboxamide?
The IUPAC name of N-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]adamantane-1-carboxamide (CID 90546468) is N-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]adamantane-1-carboxamide.
What is the SMILES notation for N-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]adamantane-1-carboxamide?
The canonical SMILES for N-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]adamantane-1-carboxamide is Cc1nc(-c2ccccc2)sc1CNC(=O)C12CC3CC(CC(C3)C1)C2.
What is the InChIKey of N-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]adamantane-1-carboxamide?
The InChIKey is WBBVYUNAGPTBAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N2OS/c1-14-19(26-20(24-14)18-5-3-2-4-6-18)13-23-21(25)22-10-15-7-16(11-22)9-17(8-15)12-22/h2-6,15-17H,7-13H2,1H3,(H,23,25).
What are the key properties of N-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]adamantane-1-carboxamide?
N-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]adamantane-1-carboxamide has a molecular weight of 366.53 g/mol, XLogP of 4.95, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)methyl]adamantane-1-carboxamide is sourced from PubChem (CID 90546468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).