C20H18ClNO3 — CID 90549144
4-(4-chlorophenyl)-N-[3-(2-methoxyphenyl)prop-2-ynyl]-4-oxobutanamide (PubChem CID 90549144) has the molecular formula C20H18ClNO3 and a molecular weight of 355.82 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[3-(2-methoxyphenyl)prop-2-ynyl]-4-oxobutanamide.
| Compound Name | 4-(4-chlorophenyl)-N-[3-(2-methoxyphenyl)prop-2-ynyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 90549144 |
| Molecular Formula | C20H18ClNO3 |
| Molecular Weight | 355.82 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[3-(2-methoxyphenyl)prop-2-ynyl]-4-oxobutanamide |
| SMILES | COc1ccccc1C#CCNC(=O)CCC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18ClNO3/c1-25-19-7-3-2-5-16(19)6-4-14-22-20(24)13-12-18(23)15-8-10-17(21)11-9-15/h2-3,5,7-11H,12-14H2,1H3,(H,22,24) |
| InChIKey | WOPJTWOXBPCTOU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.82 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|