C17H21N3O2S2 — CID 9054927
2-[methyl(thiophen-3-ylmethyl)amino]-1-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethanone (PubChem CID 9054927) has the molecular formula C17H21N3O2S2 and a molecular weight of 363.51 g/mol. Its IUPAC name is 2-[methyl(thiophen-3-ylmethyl)amino]-1-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[methyl(thiophen-3-ylmethyl)amino]-1-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 9054927 |
| Molecular Formula | C17H21N3O2S2 |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 2-[methyl(thiophen-3-ylmethyl)amino]-1-[4-(thiophene-2-carbonyl)piperazin-1-yl]ethanone |
| SMILES | CN(CC(=O)N1CCN(C(=O)c2cccs2)CC1)Cc1ccsc1 |
| InChI | InChI=1S/C17H21N3O2S2/c1-18(11-14-4-10-23-13-14)12-16(21)19-5-7-20(8-6-19)17(22)15-3-2-9-24-15/h2-4,9-10,13H,5-8,11-12H2,1H3 |
| InChIKey | MYUSRRNLYXPFOK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |