C21H19NO4 — CID 90549594
N-[3-(4-acetylphenyl)prop-2-ynyl]-2-methyl-2,3-dihydro-1,4-benzodioxine-3-carboxamide (PubChem CID 90549594) has the molecular formula C21H19NO4 and a molecular weight of 349.39 g/mol. Its IUPAC name is N-[3-(4-acetylphenyl)prop-2-ynyl]-2-methyl-2,3-dihydro-1,4-benzodioxine-3-carboxamide.
| Compound Name | N-[3-(4-acetylphenyl)prop-2-ynyl]-2-methyl-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
|---|---|
| PubChem CID | 90549594 |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | N-[3-(4-acetylphenyl)prop-2-ynyl]-2-methyl-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| SMILES | CC(=O)c1ccc(C#CCNC(=O)C2Oc3ccccc3OC2C)cc1 |
| InChI | InChI=1S/C21H19NO4/c1-14(23)17-11-9-16(10-12-17)6-5-13-22-21(24)20-15(2)25-18-7-3-4-8-19(18)26-20/h3-4,7-12,15,20H,13H2,1-2H3,(H,22,24) |
| InChIKey | ROWDLWJJZIPVKY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|