C24H26N2O2S — CID 9055359
2-[[(2R)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]-N-(2-phenylphenyl)acetamide (PubChem CID 9055359) has the molecular formula C24H26N2O2S and a molecular weight of 406.55 g/mol. Its IUPAC name is 2-[[(2R)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]-N-(2-phenylphenyl)acetamide.
| Compound Name | 2-[[(2R)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]-N-(2-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 9055359 |
| Molecular Formula | C24H26N2O2S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 2-[[(2R)-oxolan-2-yl]methyl-(thiophen-2-ylmethyl)amino]-N-(2-phenylphenyl)acetamide |
| SMILES | O=C(CN(Cc1cccs1)C[C@H]1CCCO1)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C24H26N2O2S/c27-24(25-23-13-5-4-12-22(23)19-8-2-1-3-9-19)18-26(16-20-10-6-14-28-20)17-21-11-7-15-29-21/h1-5,7-9,11-13,15,20H,6,10,14,16-18H2,(H,25,27)/t20-/m1/s1 |
| InChIKey | ZRSOACACEYQBDJ-HXUWFJFHSA-N |
| XLogP | 5.03 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |