C20H22N2O3S2 — CID 90554008
5-ethyl-N-[3-[4-(2-oxopiperidin-1-yl)phenyl]prop-2-ynyl]thiophene-2-sulfonamide (PubChem CID 90554008) has the molecular formula C20H22N2O3S2 and a molecular weight of 402.54 g/mol. Its IUPAC name is 5-ethyl-N-[3-[4-(2-oxopiperidin-1-yl)phenyl]prop-2-ynyl]thiophene-2-sulfonamide.
| Compound Name | 5-ethyl-N-[3-[4-(2-oxopiperidin-1-yl)phenyl]prop-2-ynyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 90554008 |
| Molecular Formula | C20H22N2O3S2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 5-ethyl-N-[3-[4-(2-oxopiperidin-1-yl)phenyl]prop-2-ynyl]thiophene-2-sulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)NCC#Cc2ccc(N3CCCCC3=O)cc2)s1 |
| InChI | InChI=1S/C20H22N2O3S2/c1-2-18-12-13-20(26-18)27(24,25)21-14-5-6-16-8-10-17(11-9-16)22-15-4-3-7-19(22)23/h8-13,21H,2-4,7,14-15H2,1H3 |
| InChIKey | ADQOEWNIVNKVLK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|