C17H19F3N2O2 — CID 90554666
2-(1H-indol-3-yl)-N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 90554666) has the molecular formula C17H19F3N2O2 and a molecular weight of 340.34 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(1H-indol-3-yl)-N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 90554666 |
| Molecular Formula | C17H19F3N2O2 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 2-(1H-indol-3-yl)-N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(Cc1c[nH]c2ccccc12)N(CC(F)(F)F)C1CCOCC1 |
| InChI | InChI=1S/C17H19F3N2O2/c18-17(19,20)11-22(13-5-7-24-8-6-13)16(23)9-12-10-21-15-4-2-1-3-14(12)15/h1-4,10,13,21H,5-9,11H2 |
| InChIKey | HMMZSQYILUKGEL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |