About N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)butanamide
N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)butanamide (PubChem CID 90554679) has the molecular formula C11H18F3NO2
and a molecular weight of 253.26 g/mol. Its IUPAC name is N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)butanamide.
Molecular Properties
| Compound Name | N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)butanamide |
| PubChem CID | 90554679 |
| Molecular Formula | C11H18F3NO2 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)butanamide |
| SMILES | CCCC(=O)N(CC(F)(F)F)C1CCOCC1 |
| InChI | InChI=1S/C11H18F3NO2/c1-2-3-10(16)15(8-11(12,13)14)9-4-6-17-7-5-9/h9H,2-8H2,1H3 |
| InChIKey | NLBQFIGAQNODTQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)butanamide?
The IUPAC name of N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)butanamide (CID 90554679) is N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)butanamide.
What is the SMILES notation for N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)butanamide?
The canonical SMILES for N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)butanamide is CCCC(=O)N(CC(F)(F)F)C1CCOCC1.
What is the InChIKey of N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)butanamide?
The InChIKey is NLBQFIGAQNODTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F3NO2/c1-2-3-10(16)15(8-11(12,13)14)9-4-6-17-7-5-9/h9H,2-8H2,1H3.
What are the key properties of N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)butanamide?
N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)butanamide has a molecular weight of 253.26 g/mol, XLogP of 2.36, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)butanamide is sourced from PubChem (CID 90554679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).