C14H18N4O2 — CID 90554945
2-ethoxy-N-[(1-methyl-5-pyridin-4-ylpyrazol-3-yl)methyl]acetamide (PubChem CID 90554945) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-ethoxy-N-[(1-methyl-5-pyridin-4-ylpyrazol-3-yl)methyl]acetamide.
| Compound Name | 2-ethoxy-N-[(1-methyl-5-pyridin-4-ylpyrazol-3-yl)methyl]acetamide |
|---|---|
| PubChem CID | 90554945 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2-ethoxy-N-[(1-methyl-5-pyridin-4-ylpyrazol-3-yl)methyl]acetamide |
| SMILES | CCOCC(=O)NCc1cc(-c2ccncc2)n(C)n1 |
| InChI | InChI=1S/C14H18N4O2/c1-3-20-10-14(19)16-9-12-8-13(18(2)17-12)11-4-6-15-7-5-11/h4-8H,3,9-10H2,1-2H3,(H,16,19) |
| InChIKey | OSGAHJTWTRMZNS-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |