C24H24N4O2S — CID 90556139
N-[(1-cyclopentyl-5-pyridin-2-ylpyrazol-3-yl)methyl]naphthalene-2-sulfonamide (PubChem CID 90556139) has the molecular formula C24H24N4O2S and a molecular weight of 432.55 g/mol. Its IUPAC name is N-[(1-cyclopentyl-5-pyridin-2-ylpyrazol-3-yl)methyl]naphthalene-2-sulfonamide.
| Compound Name | N-[(1-cyclopentyl-5-pyridin-2-ylpyrazol-3-yl)methyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 90556139 |
| Molecular Formula | C24H24N4O2S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | N-[(1-cyclopentyl-5-pyridin-2-ylpyrazol-3-yl)methyl]naphthalene-2-sulfonamide |
| SMILES | O=S(=O)(NCc1cc(-c2ccccn2)n(C2CCCC2)n1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H24N4O2S/c29-31(30,22-13-12-18-7-1-2-8-19(18)15-22)26-17-20-16-24(23-11-5-6-14-25-23)28(27-20)21-9-3-4-10-21/h1-2,5-8,11-16,21,26H,3-4,9-10,17H2 |
| InChIKey | HBEOSZOFIUKUOB-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |